C24H24F3N5O — CID 162541049
(16Z)-14-methyl-11-(2,2,2-trifluoroethyl)-20-oxa-5,7,14,22,27-pentazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene (PubChem CID 162541049) has the molecular formula C24H24F3N5O and a molecular weight of 455.48 g/mol. Its IUPAC name is (16Z)-14-methyl-11-(2,2,2-trifluoroethyl)-20-oxa-5,7,14,22,27-pentazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene.
| Compound Name | (16Z)-14-methyl-11-(2,2,2-trifluoroethyl)-20-oxa-5,7,14,22,27-pentazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
|---|---|
| PubChem CID | 162541049 |
| Molecular Formula | C24H24F3N5O |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (16Z)-14-methyl-11-(2,2,2-trifluoroethyl)-20-oxa-5,7,14,22,27-pentazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
| SMILES | CN1C/C=C/CCOc2cc(ccn2)-c2ccnc(n2)Nc2ccc(CC(F)(F)F)c(c2)C1 |
| InChI | InChI=1S/C24H24F3N5O/c1-32-11-3-2-4-12-33-22-14-17(7-9-28-22)21-8-10-29-23(31-21)30-20-6-5-18(15-24(25,26)27)19(13-20)16-32/h2-3,5-10,13-14H,4,11-12,15-16H2,1H3,(H,29,30,31)/b3-2+ |
| InChIKey | QMBGGVYFYMGRAV-NSCUHMNNSA-N |
| XLogP | 5.16 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|