About 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid
3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 162541465) has the molecular formula C9H4F6N2O4
and a molecular weight of 318.13 g/mol. Its IUPAC name is 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 162541465 |
| Molecular Formula | C9H4F6N2O4 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | FC(F)(F)c1ccon1.O=C(O)c1nocc1C(F)(F)F |
| InChI | InChI=1S/C5H2F3NO3.C4H2F3NO/c6-5(7,8)2-1-12-9-3(2)4(10)11;5-4(6,7)3-1-2-9-8-3/h1H,(H,10,11);1-2H |
| InChIKey | OSNQDLOWGRNCSD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid (CID 162541465) is 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid is FC(F)(F)c1ccon1.O=C(O)c1nocc1C(F)(F)F.
What is the InChIKey of 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is OSNQDLOWGRNCSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2F3NO3.C4H2F3NO/c6-5(7,8)2-1-12-9-3(2)4(10)11;5-4(6,7)3-1-2-9-8-3/h1H,(H,10,11);1-2H.
What are the key properties of 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid?
3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 318.13 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 162541465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).