C31H29F3O6S+2 — CID 162542007
[2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 4-methoxy-3-[9-oxo-2-(trifluoromethyl)-4,4a-dihydro-1H-thioxanthen-10-ium-1-ylium-10-yl]benzoate (PubChem CID 162542007) has the molecular formula C31H29F3O6S+2 and a molecular weight of 586.63 g/mol. Its IUPAC name is [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 4-methoxy-3-[9-oxo-2-(trifluoromethyl)-4,4a-dihydro-1H-thioxanthen-10-ium-1-ylium-10-yl]benzoate.
| Compound Name | [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 4-methoxy-3-[9-oxo-2-(trifluoromethyl)-4,4a-dihydro-1H-thioxanthen-10-ium-1-ylium-10-yl]benzoate |
|---|---|
| PubChem CID | 162542007 |
| Molecular Formula | C31H29F3O6S+2 |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 4-methoxy-3-[9-oxo-2-(trifluoromethyl)-4,4a-dihydro-1H-thioxanthen-10-ium-1-ylium-10-yl]benzoate |
| SMILES | CCC1(OC(=O)COC(=O)c2ccc(OC)c([S+]3c4ccccc4C(=O)C4=[C+]C(C(F)(F)F)=CCC43)c2)CCCC1 |
| InChI | InChI=1S/C31H29F3O6S/c1-3-30(14-6-7-15-30)40-27(35)18-39-29(37)19-10-12-23(38-2)26(16-19)41-24-9-5-4-8-21(24)28(36)22-17-20(31(32,33)34)11-13-25(22)41/h4-5,8-12,16,25H,3,6-7,13-15,18H2,1-2H3/q+2 |
| InChIKey | SXAOPTATZJCEIJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|