About 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium
1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium (PubChem CID 162542279) has the molecular formula C7H6ClF6S+
and a molecular weight of 271.63 g/mol. Its IUPAC name is 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium.
Molecular Properties
| Compound Name | 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium |
| PubChem CID | 162542279 |
| Molecular Formula | C7H6ClF6S+ |
| Molecular Weight | 271.63 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium |
| SMILES | FC(F)(F)C1(C(F)(F)F)CC=CC[S+]1Cl |
| InChI | InChI=1S/C7H6ClF6S/c8-15-4-2-1-3-5(15,6(9,10)11)7(12,13)14/h1-2H,3-4H2/q+1 |
| InChIKey | FISILQTTYVTDSI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium?
The IUPAC name of 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium (CID 162542279) is 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium.
What is the SMILES notation for 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium?
The canonical SMILES for 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium is FC(F)(F)C1(C(F)(F)F)CC=CC[S+]1Cl.
What is the InChIKey of 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium?
The InChIKey is FISILQTTYVTDSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClF6S/c8-15-4-2-1-3-5(15,6(9,10)11)7(12,13)14/h1-2H,3-4H2/q+1.
What are the key properties of 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium?
1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium has a molecular weight of 271.63 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran-1-ium is sourced from PubChem (CID 162542279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).