C15H11F13IN — CID 162542747
4-ethenyl-2-(1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl)pyridine;hydroiodide (PubChem CID 162542747) has the molecular formula C15H11F13IN and a molecular weight of 579.14 g/mol. Its IUPAC name is 4-ethenyl-2-(1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl)pyridine;hydroiodide.
| Compound Name | 4-ethenyl-2-(1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl)pyridine;hydroiodide |
|---|---|
| PubChem CID | 162542747 |
| Molecular Formula | C15H11F13IN |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 578.97 |
| IUPAC Name | 4-ethenyl-2-(1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl)pyridine;hydroiodide |
| SMILES | C=Cc1ccnc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F)c1.I |
| InChI | InChI=1S/C15H10F13N.HI/c1-2-8-3-6-29-9(7-8)12(21,22)14(25,26)15(27,28)13(23,24)10(16,17)4-5-11(18,19)20;/h2-3,6-7H,1,4-5H2;1H |
| InChIKey | WPLVTLMILTZGEP-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|