C27H42ClF2NO2 — CID 162543110
(2R)-1-[4-(4-chlorocyclohexa-2,4-dien-1-yl)cyclohexyl]-2-[[2-[3-(1,1-difluoroethyl)cyclohexen-1-yl]-1-hydroxyethyl]amino]-3-methylbutan-1-ol (PubChem CID 162543110) has the molecular formula C27H42ClF2NO2 and a molecular weight of 486.09 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorocyclohexa-2,4-dien-1-yl)cyclohexyl]-2-[[2-[3-(1,1-difluoroethyl)cyclohexen-1-yl]-1-hydroxyethyl]amino]-3-methylbutan-1-ol.
| Compound Name | (2R)-1-[4-(4-chlorocyclohexa-2,4-dien-1-yl)cyclohexyl]-2-[[2-[3-(1,1-difluoroethyl)cyclohexen-1-yl]-1-hydroxyethyl]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 162543110 |
| Molecular Formula | C27H42ClF2NO2 |
| Molecular Weight | 486.09 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | (2R)-1-[4-(4-chlorocyclohexa-2,4-dien-1-yl)cyclohexyl]-2-[[2-[3-(1,1-difluoroethyl)cyclohexen-1-yl]-1-hydroxyethyl]amino]-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](NC(O)CC1=CC(C(C)(F)F)CCC1)C(O)C1CCC(C2C=CC(Cl)=CC2)CC1 |
| InChI | InChI=1S/C27H42ClF2NO2/c1-17(2)25(31-24(32)16-18-5-4-6-22(15-18)27(3,29)30)26(33)21-9-7-19(8-10-21)20-11-13-23(28)14-12-20/h11,13-15,17,19-22,24-26,31-33H,4-10,12,16H2,1-3H3/t19?,20?,21?,22?,24?,25-,26?/m1/s1 |
| InChIKey | IXYMXOMJXOFYHK-DYLGZDGTSA-N |
| XLogP | 6.56 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.09 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|