C13H12F3N3O4S — CID 162543525
7-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazine-6-thione (PubChem CID 162543525) has the molecular formula C13H12F3N3O4S and a molecular weight of 363.32 g/mol. Its IUPAC name is 7-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazine-6-thione.
| Compound Name | 7-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazine-6-thione |
|---|---|
| PubChem CID | 162543525 |
| Molecular Formula | C13H12F3N3O4S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 7-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazine-6-thione |
| SMILES | OC[C@H]1O[C@@H](c2cc3ncc(C(F)(F)F)nc3[nH]c2=S)C(O)C1O |
| InChI | InChI=1S/C13H12F3N3O4S/c14-13(15,16)7-2-17-5-1-4(12(24)19-11(5)18-7)10-9(22)8(21)6(3-20)23-10/h1-2,6,8-10,20-22H,3H2,(H,18,19,24)/t6-,8?,9?,10+/m1/s1 |
| InChIKey | JJBBNULTAJSCEM-NTGXWVOYSA-N |
| XLogP | 0.86 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|