C17H15F3N6O2 — CID 162543577
(7-oxo-2-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methyl 3-amino-4,4,4-trifluoro-N-methylbut-2-enimidate (PubChem CID 162543577) has the molecular formula C17H15F3N6O2 and a molecular weight of 392.34 g/mol. Its IUPAC name is (7-oxo-2-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methyl 3-amino-4,4,4-trifluoro-N-methylbut-2-enimidate.
| Compound Name | (7-oxo-2-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methyl 3-amino-4,4,4-trifluoro-N-methylbut-2-enimidate |
|---|---|
| PubChem CID | 162543577 |
| Molecular Formula | C17H15F3N6O2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (7-oxo-2-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methyl 3-amino-4,4,4-trifluoro-N-methylbut-2-enimidate |
| SMILES | C/N=C(/C=C(N)C(F)(F)F)OCc1cc(=O)n2[nH]c(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C17H15F3N6O2/c1-22-13(8-12(21)17(18,19)20)28-9-11-7-14(27)26-16(23-11)24-15(25-26)10-5-3-2-4-6-10/h2-8H,9,21H2,1H3,(H,23,24,25)/b12-8?,22-13- |
| InChIKey | CIIJGBOPOODUOE-PVALYFADSA-N |
| XLogP | 2.03 |
| TPSA | 110.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|