C24H24F3NO3 — CID 162544025
7-[(2E,4Z)-2-ethynyl-5-piperidin-1-yl-4-(trifluoromethyl)hexa-2,4-dienoxy]-2H-chromene-3-carbaldehyde (PubChem CID 162544025) has the molecular formula C24H24F3NO3 and a molecular weight of 431.45 g/mol. Its IUPAC name is 7-[(2E,4Z)-2-ethynyl-5-piperidin-1-yl-4-(trifluoromethyl)hexa-2,4-dienoxy]-2H-chromene-3-carbaldehyde.
| Compound Name | 7-[(2E,4Z)-2-ethynyl-5-piperidin-1-yl-4-(trifluoromethyl)hexa-2,4-dienoxy]-2H-chromene-3-carbaldehyde |
|---|---|
| PubChem CID | 162544025 |
| Molecular Formula | C24H24F3NO3 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 7-[(2E,4Z)-2-ethynyl-5-piperidin-1-yl-4-(trifluoromethyl)hexa-2,4-dienoxy]-2H-chromene-3-carbaldehyde |
| SMILES | C#C/C(=C\C(=C(/C)N1CCCCC1)C(F)(F)F)COc1ccc2c(c1)OCC(C=O)=C2 |
| InChI | InChI=1S/C24H24F3NO3/c1-3-18(12-22(24(25,26)27)17(2)28-9-5-4-6-10-28)15-30-21-8-7-20-11-19(14-29)16-31-23(20)13-21/h1,7-8,11-14H,4-6,9-10,15-16H2,2H3/b18-12+,22-17- |
| InChIKey | WGZLAKMEWKQVDS-JPTVTEEHSA-N |
| XLogP | 4.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|