About (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol
(4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol (PubChem CID 162544178) has the molecular formula C6H9F2NO2
and a molecular weight of 165.14 g/mol. Its IUPAC name is (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol.
Molecular Properties
| Compound Name | (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol |
| PubChem CID | 162544178 |
| Molecular Formula | C6H9F2NO2 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol |
| SMILES | O/C=C1/CNCC(F)(F)[C@@H]1O |
| InChI | InChI=1S/C6H9F2NO2/c7-6(8)3-9-1-4(2-10)5(6)11/h2,5,9-11H,1,3H2/b4-2-/t5-/m1/s1 |
| InChIKey | IWADPLWWYYMLGN-DWFCDSDJSA-N |
| XLogP | 0.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol?
The IUPAC name of (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol (CID 162544178) is (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol.
What is the SMILES notation for (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol?
The canonical SMILES for (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol is O/C=C1/CNCC(F)(F)[C@@H]1O.
What is the InChIKey of (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol?
The InChIKey is IWADPLWWYYMLGN-DWFCDSDJSA-N. The full InChI is InChI=1S/C6H9F2NO2/c7-6(8)3-9-1-4(2-10)5(6)11/h2,5,9-11H,1,3H2/b4-2-/t5-/m1/s1.
What are the key properties of (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol?
(4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol has a molecular weight of 165.14 g/mol, XLogP of 0.03, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5Z)-3,3-difluoro-5-(hydroxymethylidene)piperidin-4-ol is sourced from PubChem (CID 162544178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).