C27H33F4N3O2 — CID 162544294
1-[3,3-dimethyl-1'-[1-[4-(3,3,3-trifluoropropoxymethyl)phenyl]ethenyl]spiro[2,4-dihydropyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]-2-fluoroethanone (PubChem CID 162544294) has the molecular formula C27H33F4N3O2 and a molecular weight of 507.57 g/mol. Its IUPAC name is 1-[3,3-dimethyl-1'-[1-[4-(3,3,3-trifluoropropoxymethyl)phenyl]ethenyl]spiro[2,4-dihydropyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]-2-fluoroethanone.
| Compound Name | 1-[3,3-dimethyl-1'-[1-[4-(3,3,3-trifluoropropoxymethyl)phenyl]ethenyl]spiro[2,4-dihydropyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]-2-fluoroethanone |
|---|---|
| PubChem CID | 162544294 |
| Molecular Formula | C27H33F4N3O2 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 1-[3,3-dimethyl-1'-[1-[4-(3,3,3-trifluoropropoxymethyl)phenyl]ethenyl]spiro[2,4-dihydropyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]-2-fluoroethanone |
| SMILES | C=C(c1ccc(COCCC(F)(F)F)cc1)N1CCC2(CC1)NC(C)(C)Cn1c(C(=O)CF)ccc12 |
| InChI | InChI=1S/C27H33F4N3O2/c1-19(21-6-4-20(5-7-21)17-36-15-12-27(29,30)31)33-13-10-26(11-14-33)24-9-8-22(23(35)16-28)34(24)18-25(2,3)32-26/h4-9,32H,1,10-18H2,2-3H3 |
| InChIKey | VGJJAUKBJFDWBE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|