C16H22F6N2O — CID 162544898
(2R)-N-[[1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 162544898) has the molecular formula C16H22F6N2O and a molecular weight of 372.35 g/mol. Its IUPAC name is (2R)-N-[[1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[[1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 162544898 |
| Molecular Formula | C16H22F6N2O |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (2R)-N-[[1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CC1C(C(F)(F)F)C=C(C(F)(F)F)CC1(C)CNC(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C16H22F6N2O/c1-9-11(16(20,21)22)6-10(15(17,18)19)7-14(9,2)8-24-13(25)12-4-3-5-23-12/h6,9,11-12,23H,3-5,7-8H2,1-2H3,(H,24,25)/t9?,11?,12-,14?/m1/s1 |
| InChIKey | FCQOVOHERJXSFT-JCFBAXGHSA-N |
| XLogP | 3.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|