C24H27F6N3O3 — CID 162545023
2-fluoro-N-(1,2-oxazol-4-ylmethyl)-4-[2-[(2R)-2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide (PubChem CID 162545023) has the molecular formula C24H27F6N3O3 and a molecular weight of 519.49 g/mol. Its IUPAC name is 2-fluoro-N-(1,2-oxazol-4-ylmethyl)-4-[2-[(2R)-2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide.
| Compound Name | 2-fluoro-N-(1,2-oxazol-4-ylmethyl)-4-[2-[(2R)-2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide |
|---|---|
| PubChem CID | 162545023 |
| Molecular Formula | C24H27F6N3O3 |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 2-fluoro-N-(1,2-oxazol-4-ylmethyl)-4-[2-[(2R)-2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide |
| SMILES | O=C(NCc1cnoc1)c1ccc(OCCC2C[C@@H]2C2CCN(CC(F)(F)C(F)(F)F)CC2)cc1F |
| InChI | InChI=1S/C24H27F6N3O3/c25-21-10-18(1-2-19(21)22(34)31-11-15-12-32-36-13-15)35-8-5-17-9-20(17)16-3-6-33(7-4-16)14-23(26,27)24(28,29)30/h1-2,10,12-13,16-17,20H,3-9,11,14H2,(H,31,34)/t17?,20-/m1/s1 |
| InChIKey | UYYVMULFKCMPAN-UUSAFJCLSA-N |
| XLogP | 5.06 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|