C17H18ClF2N3O2 — CID 162545325
1-[[6-chloro-5-(1,1-difluoroethyl)-2-pyridinyl]amino]-3-(2-cyclopropylethyl)-4-methylpyrrole-2,5-dione (PubChem CID 162545325) has the molecular formula C17H18ClF2N3O2 and a molecular weight of 369.80 g/mol. Its IUPAC name is 1-[[6-chloro-5-(1,1-difluoroethyl)-2-pyridinyl]amino]-3-(2-cyclopropylethyl)-4-methylpyrrole-2,5-dione.
| Compound Name | 1-[[6-chloro-5-(1,1-difluoroethyl)-2-pyridinyl]amino]-3-(2-cyclopropylethyl)-4-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 162545325 |
| Molecular Formula | C17H18ClF2N3O2 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-[[6-chloro-5-(1,1-difluoroethyl)-2-pyridinyl]amino]-3-(2-cyclopropylethyl)-4-methylpyrrole-2,5-dione |
| SMILES | CC1=C(CCC2CC2)C(=O)N(Nc2ccc(C(C)(F)F)c(Cl)n2)C1=O |
| InChI | InChI=1S/C17H18ClF2N3O2/c1-9-11(6-5-10-3-4-10)16(25)23(15(9)24)22-13-8-7-12(14(18)21-13)17(2,19)20/h7-8,10H,3-6H2,1-2H3,(H,21,22) |
| InChIKey | GGQGXOCHBBYBEB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|