About (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol
(E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol (PubChem CID 162545469) has the molecular formula C8H14F2O2
and a molecular weight of 180.19 g/mol. Its IUPAC name is (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol |
| PubChem CID | 162545469 |
| Molecular Formula | C8H14F2O2 |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol |
| SMILES | CCCOC(O)/C=C(\C)C(F)F |
| InChI | InChI=1S/C8H14F2O2/c1-3-4-12-7(11)5-6(2)8(9)10/h5,7-8,11H,3-4H2,1-2H3/b6-5+ |
| InChIKey | RCQQOIYCQPAPFJ-AATRIKPKSA-N |
| XLogP | 1.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol?
The IUPAC name of (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol (CID 162545469) is (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol.
What is the SMILES notation for (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol?
The canonical SMILES for (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol is CCCOC(O)/C=C(\C)C(F)F.
What is the InChIKey of (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol?
The InChIKey is RCQQOIYCQPAPFJ-AATRIKPKSA-N. The full InChI is InChI=1S/C8H14F2O2/c1-3-4-12-7(11)5-6(2)8(9)10/h5,7-8,11H,3-4H2,1-2H3/b6-5+.
What are the key properties of (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol?
(E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol has a molecular weight of 180.19 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,4-difluoro-3-methyl-1-propoxybut-2-en-1-ol is sourced from PubChem (CID 162545469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).