C12H10F3N2O2S+ — CID 162545826
methyl 4-amino-3-[3-(trifluoromethyl)phenyl]-1,2-thiazol-1-ium-1-carboxylate (PubChem CID 162545826) has the molecular formula C12H10F3N2O2S+ and a molecular weight of 303.29 g/mol. Its IUPAC name is methyl 4-amino-3-[3-(trifluoromethyl)phenyl]-1,2-thiazol-1-ium-1-carboxylate.
| Compound Name | methyl 4-amino-3-[3-(trifluoromethyl)phenyl]-1,2-thiazol-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 162545826 |
| Molecular Formula | C12H10F3N2O2S+ |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | methyl 4-amino-3-[3-(trifluoromethyl)phenyl]-1,2-thiazol-1-ium-1-carboxylate |
| SMILES | COC(=O)[s+]1cc(N)c(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C12H10F3N2O2S/c1-19-11(18)20-6-9(16)10(17-20)7-3-2-4-8(5-7)12(13,14)15/h2-6H,16H2,1H3/q+1 |
| InChIKey | YTWVZHJHMXXOFW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|