C34H50F6O4SSi2 — CID 162546180
(3E,5E)-6-[5-[[3,4-bis(2-tert-butylsilyloxypropan-2-yl)phenoxy]methyl]thiophen-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol (PubChem CID 162546180) has the molecular formula C34H50F6O4SSi2 and a molecular weight of 725.00 g/mol. Its IUPAC name is (3E,5E)-6-[5-[[3,4-bis(2-tert-butylsilyloxypropan-2-yl)phenoxy]methyl]thiophen-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol.
| Compound Name | (3E,5E)-6-[5-[[3,4-bis(2-tert-butylsilyloxypropan-2-yl)phenoxy]methyl]thiophen-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 162546180 |
| Molecular Formula | C34H50F6O4SSi2 |
| Molecular Weight | 725.00 g/mol |
| Exact Mass | 724.29 |
| IUPAC Name | (3E,5E)-6-[5-[[3,4-bis(2-tert-butylsilyloxypropan-2-yl)phenoxy]methyl]thiophen-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol |
| SMILES | CC/C(=C\C=C\C(O)(C(F)(F)F)C(F)(F)F)c1ccc(COc2ccc(C(C)(C)O[SiH2]C(C)(C)C)c(C(C)(C)O[SiH2]C(C)(C)C)c2)s1 |
| InChI | InChI=1S/C34H50F6O4SSi2/c1-12-22(14-13-19-32(41,33(35,36)37)34(38,39)40)27-18-16-24(45-27)21-42-23-15-17-25(30(8,9)43-46-28(2,3)4)26(20-23)31(10,11)44-47-29(5,6)7/h13-20,41H,12,21,46-47H2,1-11H3/b19-13+,22-14+ |
| InChIKey | JMHIWSMZEXSBMT-QTLAEQSKSA-N |
| XLogP | 9.64 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.00 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|