C25H26F2N6O — CID 162546443
3,3-difluoro-2-[[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]methyl]-2-phenylpent-4-enal (PubChem CID 162546443) has the molecular formula C25H26F2N6O and a molecular weight of 464.52 g/mol. Its IUPAC name is 3,3-difluoro-2-[[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]methyl]-2-phenylpent-4-enal.
| Compound Name | 3,3-difluoro-2-[[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]methyl]-2-phenylpent-4-enal |
|---|---|
| PubChem CID | 162546443 |
| Molecular Formula | C25H26F2N6O |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 3,3-difluoro-2-[[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]methyl]-2-phenylpent-4-enal |
| SMILES | C=CC(F)(F)C(C=O)(CNC1CCC(c2nnn3cnc4[nH]ccc4c23)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H26F2N6O/c1-2-25(26,27)24(15-34,18-6-4-3-5-7-18)14-29-19-10-8-17(9-11-19)21-22-20-12-13-28-23(20)30-16-33(22)32-31-21/h2-7,12-13,15-17,19,28-29H,1,8-11,14H2 |
| InChIKey | KHJNDRGUBXFIKG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|