About 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium
3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium (PubChem CID 162546686) has the molecular formula C17H17F3N+
and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium.
Molecular Properties
| Compound Name | 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium |
| PubChem CID | 162546686 |
| Molecular Formula | C17H17F3N+ |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium |
| SMILES | CC1=[N+]=C(C2C=CC=CC2C(F)(F)F)C2CC=CC=C2C1 |
| InChI | InChI=1S/C17H17F3N/c1-11-10-12-6-2-3-7-13(12)16(21-11)14-8-4-5-9-15(14)17(18,19)20/h2-6,8-9,13-15H,7,10H2,1H3/q+1 |
| InChIKey | HGKZWPDFPTUIHO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium?
The IUPAC name of 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium (CID 162546686) is 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium.
What is the SMILES notation for 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium?
The canonical SMILES for 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium is CC1=[N+]=C(C2C=CC=CC2C(F)(F)F)C2CC=CC=C2C1.
What is the InChIKey of 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium?
The InChIKey is HGKZWPDFPTUIHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3N/c1-11-10-12-6-2-3-7-13(12)16(21-11)14-8-4-5-9-15(14)17(18,19)20/h2-6,8-9,13-15H,7,10H2,1H3/q+1.
What are the key properties of 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium?
3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium has a molecular weight of 292.32 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-8,8a-dihydro-4H-isoquinolin-2-ium is sourced from PubChem (CID 162546686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).