About N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide
N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide (PubChem CID 162546698) has the molecular formula C7H11F3N2O
and a molecular weight of 196.17 g/mol. Its IUPAC name is N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide |
| PubChem CID | 162546698 |
| Molecular Formula | C7H11F3N2O |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide |
| SMILES | C=C(NC(C)=O)C(CN)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O/c1-4(12-5(2)13)6(3-11)7(8,9)10/h6H,1,3,11H2,2H3,(H,12,13) |
| InChIKey | JINAKUAAFHFCLG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide?
The IUPAC name of N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide (CID 162546698) is N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide.
What is the SMILES notation for N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide?
The canonical SMILES for N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide is C=C(NC(C)=O)C(CN)C(F)(F)F.
What is the InChIKey of N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide?
The InChIKey is JINAKUAAFHFCLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3N2O/c1-4(12-5(2)13)6(3-11)7(8,9)10/h6H,1,3,11H2,2H3,(H,12,13).
What are the key properties of N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide?
N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide has a molecular weight of 196.17 g/mol, XLogP of 0.77, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(aminomethyl)-4,4,4-trifluorobut-1-en-2-yl]acetamide is sourced from PubChem (CID 162546698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).