About 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine
3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 162546843) has the molecular formula C12H16F3NS2
and a molecular weight of 295.40 g/mol. Its IUPAC name is 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 162546843 |
| Molecular Formula | C12H16F3NS2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=C(C2CSCCCS2)C(C(F)(F)F)=CC1 |
| InChI | InChI=1S/C12H16F3NS2/c13-12(14,15)10-3-2-8(16)6-9(10)11-7-17-4-1-5-18-11/h3,6,8,11H,1-2,4-5,7,16H2 |
| InChIKey | XJWDFRNDDHAWST-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (CID 162546843) is 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is NC1C=C(C2CSCCCS2)C(C(F)(F)F)=CC1.
What is the InChIKey of 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The InChIKey is XJWDFRNDDHAWST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NS2/c13-12(14,15)10-3-2-8(16)6-9(10)11-7-17-4-1-5-18-11/h3,6,8,11H,1-2,4-5,7,16H2.
What are the key properties of 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine has a molecular weight of 295.40 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dithiepan-2-yl)-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 162546843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).