C22H28F3N — CID 162546879
4-[(3E,7E)-7-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]nona-3,7-dien-2-yl]cyclohex-3-en-1-imine (PubChem CID 162546879) has the molecular formula C22H28F3N and a molecular weight of 363.47 g/mol. Its IUPAC name is 4-[(3E,7E)-7-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]nona-3,7-dien-2-yl]cyclohex-3-en-1-imine.
| Compound Name | 4-[(3E,7E)-7-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]nona-3,7-dien-2-yl]cyclohex-3-en-1-imine |
|---|---|
| PubChem CID | 162546879 |
| Molecular Formula | C22H28F3N |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 4-[(3E,7E)-7-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]nona-3,7-dien-2-yl]cyclohex-3-en-1-imine |
| SMILES | [H]/N=C1\CC=C(C(C)/C=C/CC/C(=C\C)C2C=C(C(F)(F)F)C=CC2)CC1 |
| InChI | InChI=1S/C22H28F3N/c1-3-17(19-9-6-10-20(15-19)22(23,24)25)8-5-4-7-16(2)18-11-13-21(26)14-12-18/h3-4,6-7,10-11,15-16,19,26H,5,8-9,12-14H2,1-2H3/b7-4+,17-3+,26-21+ |
| InChIKey | GVKHCEQKISNVKI-NEGJEKLWSA-N |
| XLogP | 7.10 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|