C14H16F3N — CID 162547068
7-[[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]-5,6-dihydro-2H-azepine (PubChem CID 162547068) has the molecular formula C14H16F3N and a molecular weight of 255.28 g/mol. Its IUPAC name is 7-[[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]-5,6-dihydro-2H-azepine.
| Compound Name | 7-[[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]-5,6-dihydro-2H-azepine |
|---|---|
| PubChem CID | 162547068 |
| Molecular Formula | C14H16F3N |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 7-[[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]-5,6-dihydro-2H-azepine |
| SMILES | FC(F)(F)C1=CCCC(CC2=NCC=CCC2)=C1 |
| InChI | InChI=1S/C14H16F3N/c15-14(16,17)12-6-4-5-11(9-12)10-13-7-2-1-3-8-18-13/h1,3,6,9H,2,4-5,7-8,10H2 |
| InChIKey | QPAJYONQEVJRPC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|