About 2,2-difluoro-3H-1,3-benzothiazole
2,2-difluoro-3H-1,3-benzothiazole (PubChem CID 162547597) has the molecular formula C7H5F2NS
and a molecular weight of 173.19 g/mol. Its IUPAC name is 2,2-difluoro-3H-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2,2-difluoro-3H-1,3-benzothiazole |
| PubChem CID | 162547597 |
| Molecular Formula | C7H5F2NS |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 2,2-difluoro-3H-1,3-benzothiazole |
| SMILES | FC1(F)Nc2ccccc2S1 |
| InChI | InChI=1S/C7H5F2NS/c8-7(9)10-5-3-1-2-4-6(5)11-7/h1-4,10H |
| InChIKey | CJUNWSKMOFPQNT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-3H-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-3H-1,3-benzothiazole?
The IUPAC name of 2,2-difluoro-3H-1,3-benzothiazole (CID 162547597) is 2,2-difluoro-3H-1,3-benzothiazole.
What is the SMILES notation for 2,2-difluoro-3H-1,3-benzothiazole?
The canonical SMILES for 2,2-difluoro-3H-1,3-benzothiazole is FC1(F)Nc2ccccc2S1.
What is the InChIKey of 2,2-difluoro-3H-1,3-benzothiazole?
The InChIKey is CJUNWSKMOFPQNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F2NS/c8-7(9)10-5-3-1-2-4-6(5)11-7/h1-4,10H.
What are the key properties of 2,2-difluoro-3H-1,3-benzothiazole?
2,2-difluoro-3H-1,3-benzothiazole has a molecular weight of 173.19 g/mol, XLogP of 2.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3H-1,3-benzothiazole is sourced from PubChem (CID 162547597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).