C10H15F4NO — CID 162547679
N,N-diethyl-4,5,5,5-tetrafluoro-2-methylidenepentanamide (PubChem CID 162547679) has the molecular formula C10H15F4NO and a molecular weight of 241.23 g/mol. Its IUPAC name is N,N-diethyl-4,5,5,5-tetrafluoro-2-methylidenepentanamide.
| Compound Name | N,N-diethyl-4,5,5,5-tetrafluoro-2-methylidenepentanamide |
|---|---|
| PubChem CID | 162547679 |
| Molecular Formula | C10H15F4NO |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N,N-diethyl-4,5,5,5-tetrafluoro-2-methylidenepentanamide |
| SMILES | C=C(CC(F)C(F)(F)F)C(=O)N(CC)CC |
| InChI | InChI=1S/C10H15F4NO/c1-4-15(5-2)9(16)7(3)6-8(11)10(12,13)14/h8H,3-6H2,1-2H3 |
| InChIKey | SAAWKAHUWSDLSM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|