About (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid
(Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid (PubChem CID 162548394) has the molecular formula C18H13F2NO3
and a molecular weight of 329.30 g/mol. Its IUPAC name is (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid |
| PubChem CID | 162548394 |
| Molecular Formula | C18H13F2NO3 |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid |
| SMILES | N/C(=C\C(=O)O)c1ccc(C(=O)C(=C(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H13F2NO3/c19-18(20)16(12-4-2-1-3-5-12)17(24)13-8-6-11(7-9-13)14(21)10-15(22)23/h1-10H,21H2,(H,22,23)/b14-10- |
| InChIKey | BZXQRAXUJQDTHQ-UVTDQMKNSA-N |
| XLogP | 3.56 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid?
The IUPAC name of (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid (CID 162548394) is (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid.
What is the SMILES notation for (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid?
The canonical SMILES for (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid is N/C(=C\C(=O)O)c1ccc(C(=O)C(=C(F)F)c2ccccc2)cc1.
What is the InChIKey of (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid?
The InChIKey is BZXQRAXUJQDTHQ-UVTDQMKNSA-N. The full InChI is InChI=1S/C18H13F2NO3/c19-18(20)16(12-4-2-1-3-5-12)17(24)13-8-6-11(7-9-13)14(21)10-15(22)23/h1-10H,21H2,(H,22,23)/b14-10-.
What are the key properties of (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid?
(Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid has a molecular weight of 329.30 g/mol, XLogP of 3.56, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-3-[4-(3,3-difluoro-2-phenylprop-2-enoyl)phenyl]prop-2-enoic acid is sourced from PubChem (CID 162548394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).