C12H14F6O2S — CID 162548885
5-[3,3,3-trifluoro-2-methylsulfonyl-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 162548885) has the molecular formula C12H14F6O2S and a molecular weight of 336.30 g/mol. Its IUPAC name is 5-[3,3,3-trifluoro-2-methylsulfonyl-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-[3,3,3-trifluoro-2-methylsulfonyl-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 162548885 |
| Molecular Formula | C12H14F6O2S |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 5-[3,3,3-trifluoro-2-methylsulfonyl-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | CS(=O)(=O)C(CC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6O2S/c1-21(19,20)10(11(13,14)15,12(16,17)18)6-9-5-7-2-3-8(9)4-7/h2-3,7-9H,4-6H2,1H3 |
| InChIKey | ACKVOKRWZSGCKM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|