C34H38F3N5O — CID 162548989
3-[(1R,3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]-N-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-1-[2-(1,2,4-triazol-4-yl)cyclopropyl]cyclopentane-1-carboxamide (PubChem CID 162548989) has the molecular formula C34H38F3N5O and a molecular weight of 589.71 g/mol. Its IUPAC name is 3-[(1R,3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]-N-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-1-[2-(1,2,4-triazol-4-yl)cyclopropyl]cyclopentane-1-carboxamide.
| Compound Name | 3-[(1R,3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]-N-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-1-[2-(1,2,4-triazol-4-yl)cyclopropyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 162548989 |
| Molecular Formula | C34H38F3N5O |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | 3-[(1R,3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]-N-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-1-[2-(1,2,4-triazol-4-yl)cyclopropyl]cyclopentane-1-carboxamide |
| SMILES | Cc1cc(CNC(=O)C2(C3CC3n3cnnc3)CCC(N3CC[C@@]4(C=Cc5ccccc54)[C@@H](C)C3)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H38F3N5O/c1-22-13-24(15-26(14-22)34(35,36)37)18-38-31(43)33(29-16-30(29)42-20-39-40-21-42)10-8-27(17-33)41-12-11-32(23(2)19-41)9-7-25-5-3-4-6-28(25)32/h3-7,9,13-15,20-21,23,27,29-30H,8,10-12,16-19H2,1-2H3,(H,38,43)/t23-,27?,29?,30?,32-,33?/m0/s1 |
| InChIKey | UPAYBMQRLDNIPF-KFSFIHOESA-N |
| XLogP | 6.33 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |