C20H23F3N6O4 — CID 162549158
[4-[7-but-2-ynyl-1-methyl-3-(2-methylprop-2-enyl)-2,6-dioxopurin-8-yl]piperazin-2-yl] 2,2,2-trifluoroacetate (PubChem CID 162549158) has the molecular formula C20H23F3N6O4 and a molecular weight of 468.44 g/mol. Its IUPAC name is [4-[7-but-2-ynyl-1-methyl-3-(2-methylprop-2-enyl)-2,6-dioxopurin-8-yl]piperazin-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[7-but-2-ynyl-1-methyl-3-(2-methylprop-2-enyl)-2,6-dioxopurin-8-yl]piperazin-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162549158 |
| Molecular Formula | C20H23F3N6O4 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | [4-[7-but-2-ynyl-1-methyl-3-(2-methylprop-2-enyl)-2,6-dioxopurin-8-yl]piperazin-2-yl] 2,2,2-trifluoroacetate |
| SMILES | C=C(C)Cn1c(=O)n(C)c(=O)c2c1nc(N1CCNC(OC(=O)C(F)(F)F)C1)n2CC#CC |
| InChI | InChI=1S/C20H23F3N6O4/c1-5-6-8-28-14-15(29(10-12(2)3)19(32)26(4)16(14)30)25-18(28)27-9-7-24-13(11-27)33-17(31)20(21,22)23/h13,24H,2,7-11H2,1,3-4H3 |
| InChIKey | MKEUVUPNNDUALE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|