C17H19F3N2O2 — CID 162549412
9-methyl-3-(trifluoromethyl)spiro[3,4,5,9,9a,10-hexahydropyrrolo[1,2-g][1,6]naphthyridine-8,3'-cyclopentane]-1',7-dione (PubChem CID 162549412) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is 9-methyl-3-(trifluoromethyl)spiro[3,4,5,9,9a,10-hexahydropyrrolo[1,2-g][1,6]naphthyridine-8,3'-cyclopentane]-1',7-dione.
| Compound Name | 9-methyl-3-(trifluoromethyl)spiro[3,4,5,9,9a,10-hexahydropyrrolo[1,2-g][1,6]naphthyridine-8,3'-cyclopentane]-1',7-dione |
|---|---|
| PubChem CID | 162549412 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 9-methyl-3-(trifluoromethyl)spiro[3,4,5,9,9a,10-hexahydropyrrolo[1,2-g][1,6]naphthyridine-8,3'-cyclopentane]-1',7-dione |
| SMILES | CC1C2CC3=C(CC(C(F)(F)F)C=N3)CN2C(=O)C12CCC(=O)C2 |
| InChI | InChI=1S/C17H19F3N2O2/c1-9-14-5-13-10(4-11(7-21-13)17(18,19)20)8-22(14)15(24)16(9)3-2-12(23)6-16/h7,9,11,14H,2-6,8H2,1H3 |
| InChIKey | GMYAASJKVSIUBF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |