About [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane
[1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane (PubChem CID 162549759) has the molecular formula C12H16F3P
and a molecular weight of 248.23 g/mol. Its IUPAC name is [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane.
Molecular Properties
| Compound Name | [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane |
| PubChem CID | 162549759 |
| Molecular Formula | C12H16F3P |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane |
| SMILES | CCc1ccc(C(C)(F)F)cc1C(C)(F)P |
| InChI | InChI=1S/C12H16F3P/c1-4-8-5-6-9(11(2,13)14)7-10(8)12(3,15)16/h5-7H,4,16H2,1-3H3 |
| InChIKey | BIDNHPHRJQWTOT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane?
The IUPAC name of [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane (CID 162549759) is [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane.
What is the SMILES notation for [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane?
The canonical SMILES for [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane is CCc1ccc(C(C)(F)F)cc1C(C)(F)P.
What is the InChIKey of [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane?
The InChIKey is BIDNHPHRJQWTOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3P/c1-4-8-5-6-9(11(2,13)14)7-10(8)12(3,15)16/h5-7H,4,16H2,1-3H3.
What are the key properties of [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane?
[1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane has a molecular weight of 248.23 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[5-(1,1-difluoroethyl)-2-ethylphenyl]-1-fluoroethyl]phosphane is sourced from PubChem (CID 162549759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).