C13H10F3N5O2 — CID 162549879
3-oxo-12-(2,2,2-trifluoroacetyl)-1,4,6,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),5,8-triene-8-carbonitrile (PubChem CID 162549879) has the molecular formula C13H10F3N5O2 and a molecular weight of 325.25 g/mol. Its IUPAC name is 3-oxo-12-(2,2,2-trifluoroacetyl)-1,4,6,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),5,8-triene-8-carbonitrile.
| Compound Name | 3-oxo-12-(2,2,2-trifluoroacetyl)-1,4,6,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),5,8-triene-8-carbonitrile |
|---|---|
| PubChem CID | 162549879 |
| Molecular Formula | C13H10F3N5O2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 3-oxo-12-(2,2,2-trifluoroacetyl)-1,4,6,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),5,8-triene-8-carbonitrile |
| SMILES | N#Cc1c2n(c3c(=O)[nH]cnc13)CCN(C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C13H10F3N5O2/c14-13(15,16)12(23)20-2-1-8-7(5-17)9-10(21(8)4-3-20)11(22)19-6-18-9/h6H,1-4H2,(H,18,19,22) |
| InChIKey | NPJUCLAKLPFYLS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |