C22H23F2IN4O2 — CID 162551168
[4-[5-[difluoro(iodo)methyl]-2-methoxyanilino]-1-methylpyrrolo[3,2-c]pyridin-7-yl]-piperidin-1-ylmethanone (PubChem CID 162551168) has the molecular formula C22H23F2IN4O2 and a molecular weight of 540.35 g/mol. Its IUPAC name is [4-[5-[difluoro(iodo)methyl]-2-methoxyanilino]-1-methylpyrrolo[3,2-c]pyridin-7-yl]-piperidin-1-ylmethanone.
| Compound Name | [4-[5-[difluoro(iodo)methyl]-2-methoxyanilino]-1-methylpyrrolo[3,2-c]pyridin-7-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 162551168 |
| Molecular Formula | C22H23F2IN4O2 |
| Molecular Weight | 540.35 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | [4-[5-[difluoro(iodo)methyl]-2-methoxyanilino]-1-methylpyrrolo[3,2-c]pyridin-7-yl]-piperidin-1-ylmethanone |
| SMILES | COc1ccc(C(F)(F)I)cc1Nc1ncc(C(=O)N2CCCCC2)c2c1ccn2C |
| InChI | InChI=1S/C22H23F2IN4O2/c1-28-11-8-15-19(28)16(21(30)29-9-4-3-5-10-29)13-26-20(15)27-17-12-14(22(23,24)25)6-7-18(17)31-2/h6-8,11-13H,3-5,9-10H2,1-2H3,(H,26,27) |
| InChIKey | VLSODBGKJRRLQA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.35 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|