C13H18F6O — CID 162551568
1,1,1-trifluoro-4-(5-propylcyclopent-2-en-1-yl)-2-(trifluoromethyl)butan-2-ol (PubChem CID 162551568) has the molecular formula C13H18F6O and a molecular weight of 304.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(5-propylcyclopent-2-en-1-yl)-2-(trifluoromethyl)butan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-(5-propylcyclopent-2-en-1-yl)-2-(trifluoromethyl)butan-2-ol |
|---|---|
| PubChem CID | 162551568 |
| Molecular Formula | C13H18F6O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1,1,1-trifluoro-4-(5-propylcyclopent-2-en-1-yl)-2-(trifluoromethyl)butan-2-ol |
| SMILES | CCCC1CC=CC1CCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H18F6O/c1-2-4-9-5-3-6-10(9)7-8-11(20,12(14,15)16)13(17,18)19/h3,6,9-10,20H,2,4-5,7-8H2,1H3 |
| InChIKey | BRJISPYECVRGIX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|