C13H10F12O2 — CID 162551574
1,1,1,3,3,3-hexafluoro-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methylcyclohexa-1,5-dien-1-yl]propan-2-ol (PubChem CID 162551574) has the molecular formula C13H10F12O2 and a molecular weight of 426.20 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methylcyclohexa-1,5-dien-1-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methylcyclohexa-1,5-dien-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 162551574 |
| Molecular Formula | C13H10F12O2 |
| Molecular Weight | 426.20 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methylcyclohexa-1,5-dien-1-yl]propan-2-ol |
| SMILES | CC1CC=C(C(O)(C(F)(F)F)C(F)(F)F)C=C1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H10F12O2/c1-5-2-3-6(8(26,10(14,15)16)11(17,18)19)4-7(5)9(27,12(20,21)22)13(23,24)25/h3-5,26-27H,2H2,1H3 |
| InChIKey | DZDQYTLJFPRCEF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.20 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |