C19H28F6O — CID 162551777
2-[(4-tert-butyl-5-prop-1-en-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 162551777) has the molecular formula C19H28F6O and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-[(4-tert-butyl-5-prop-1-en-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[(4-tert-butyl-5-prop-1-en-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 162551777 |
| Molecular Formula | C19H28F6O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-[(4-tert-butyl-5-prop-1-en-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C=C(C)C1CC2CC(CC(O)(C(F)(F)F)C(F)(F)F)CC2C1C(C)(C)C |
| InChI | InChI=1S/C19H28F6O/c1-10(2)13-8-12-6-11(7-14(12)15(13)16(3,4)5)9-17(26,18(20,21)22)19(23,24)25/h11-15,26H,1,6-9H2,2-5H3 |
| InChIKey | CGWOSMJEOQMCDM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|