C22H25F3N2O — CID 162551792
(2E)-2-[[2,5-dimethyl-4-[4-(3,3,3-trifluoropropylamino)phenyl]phenyl]methylidene]butanamide (PubChem CID 162551792) has the molecular formula C22H25F3N2O and a molecular weight of 390.45 g/mol. Its IUPAC name is (2E)-2-[[2,5-dimethyl-4-[4-(3,3,3-trifluoropropylamino)phenyl]phenyl]methylidene]butanamide.
| Compound Name | (2E)-2-[[2,5-dimethyl-4-[4-(3,3,3-trifluoropropylamino)phenyl]phenyl]methylidene]butanamide |
|---|---|
| PubChem CID | 162551792 |
| Molecular Formula | C22H25F3N2O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (2E)-2-[[2,5-dimethyl-4-[4-(3,3,3-trifluoropropylamino)phenyl]phenyl]methylidene]butanamide |
| SMILES | CC/C(=C\c1cc(C)c(-c2ccc(NCCC(F)(F)F)cc2)cc1C)C(N)=O |
| InChI | InChI=1S/C22H25F3N2O/c1-4-16(21(26)28)13-18-11-15(3)20(12-14(18)2)17-5-7-19(8-6-17)27-10-9-22(23,24)25/h5-8,11-13,27H,4,9-10H2,1-3H3,(H2,26,28)/b16-13+ |
| InChIKey | SRWLWILRUWVUNK-DTQAZKPQSA-N |
| XLogP | 5.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|