C24H30F4O6 — CID 162551976
[(1R,2S,13S,14S,17S)-1-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,11,13-trimethyl-5-oxo-17-tricyclo[8.7.0.02,7]heptadeca-3,6-dienyl] 2,2,2-trifluoroacetate (PubChem CID 162551976) has the molecular formula C24H30F4O6 and a molecular weight of 490.49 g/mol. Its IUPAC name is [(1R,2S,13S,14S,17S)-1-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,11,13-trimethyl-5-oxo-17-tricyclo[8.7.0.02,7]heptadeca-3,6-dienyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,2S,13S,14S,17S)-1-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,11,13-trimethyl-5-oxo-17-tricyclo[8.7.0.02,7]heptadeca-3,6-dienyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162551976 |
| Molecular Formula | C24H30F4O6 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [(1R,2S,13S,14S,17S)-1-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,11,13-trimethyl-5-oxo-17-tricyclo[8.7.0.02,7]heptadeca-3,6-dienyl] 2,2,2-trifluoroacetate |
| SMILES | CC1C[C@H](C)[C@](O)(C(=O)CO)CC[C@H](OC(=O)C(F)(F)F)[C@@]2(F)C1CCC1=CC(=O)C=C[C@@]12C |
| InChI | InChI=1S/C24H30F4O6/c1-13-10-14(2)22(33,18(31)12-29)9-7-19(34-20(32)24(26,27)28)23(25)17(13)5-4-15-11-16(30)6-8-21(15,23)3/h6,8,11,13-14,17,19,29,33H,4-5,7,9-10,12H2,1-3H3/t13?,14-,17?,19-,21-,22-,23-/m0/s1 |
| InChIKey | WMWPLDMFZPEVJA-JZXNYKQFSA-N |
| XLogP | 3.40 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |