C19H22F2N4O3 — CID 162552368
N-cyclohexyl-4-(1,1-difluoroethyl)-2-(3,4-dihydroxyanilino)pyrimidine-5-carboxamide (PubChem CID 162552368) has the molecular formula C19H22F2N4O3 and a molecular weight of 392.41 g/mol. Its IUPAC name is N-cyclohexyl-4-(1,1-difluoroethyl)-2-(3,4-dihydroxyanilino)pyrimidine-5-carboxamide.
| Compound Name | N-cyclohexyl-4-(1,1-difluoroethyl)-2-(3,4-dihydroxyanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 162552368 |
| Molecular Formula | C19H22F2N4O3 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-cyclohexyl-4-(1,1-difluoroethyl)-2-(3,4-dihydroxyanilino)pyrimidine-5-carboxamide |
| SMILES | CC(F)(F)c1nc(Nc2ccc(O)c(O)c2)ncc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H22F2N4O3/c1-19(20,21)16-13(17(28)23-11-5-3-2-4-6-11)10-22-18(25-16)24-12-7-8-14(26)15(27)9-12/h7-11,26-27H,2-6H2,1H3,(H,23,28)(H,22,24,25) |
| InChIKey | UUPAURIWNVXCFP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|