About 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine
1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine (PubChem CID 162552482) has the molecular formula C16H25F2N
and a molecular weight of 269.38 g/mol. Its IUPAC name is 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine.
Molecular Properties
| Compound Name | 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine |
| PubChem CID | 162552482 |
| Molecular Formula | C16H25F2N |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine |
| SMILES | C/C=C/C(F)(F)C1CC(C)=C[C@@H](N2CCCCC2)C1 |
| InChI | InChI=1S/C16H25F2N/c1-3-7-16(17,18)14-10-13(2)11-15(12-14)19-8-5-4-6-9-19/h3,7,11,14-15H,4-6,8-10,12H2,1-2H3/b7-3+/t14?,15-/m1/s1 |
| InChIKey | FEXRKOGNSFMEAE-JCGYVEBJSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine?
The IUPAC name of 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine (CID 162552482) is 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine.
What is the SMILES notation for 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine?
The canonical SMILES for 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine is C/C=C/C(F)(F)C1CC(C)=C[C@@H](N2CCCCC2)C1.
What is the InChIKey of 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine?
The InChIKey is FEXRKOGNSFMEAE-JCGYVEBJSA-N. The full InChI is InChI=1S/C16H25F2N/c1-3-7-16(17,18)14-10-13(2)11-15(12-14)19-8-5-4-6-9-19/h3,7,11,14-15H,4-6,8-10,12H2,1-2H3/b7-3+/t14?,15-/m1/s1.
What are the key properties of 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine?
1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine has a molecular weight of 269.38 g/mol, XLogP of 4.41, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-5-[(E)-1,1-difluorobut-2-enyl]-3-methylcyclohex-2-en-1-yl]piperidine is sourced from PubChem (CID 162552482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).