C18H23F3N2O4 — CID 162552615
3-[[6-ethyl-5-methyl-1-(3-methylbut-3-enyl)-2-oxopyridine-3-carbonyl]amino]-4,4,4-trifluorobutanoic acid (PubChem CID 162552615) has the molecular formula C18H23F3N2O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is 3-[[6-ethyl-5-methyl-1-(3-methylbut-3-enyl)-2-oxopyridine-3-carbonyl]amino]-4,4,4-trifluorobutanoic acid.
| Compound Name | 3-[[6-ethyl-5-methyl-1-(3-methylbut-3-enyl)-2-oxopyridine-3-carbonyl]amino]-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 162552615 |
| Molecular Formula | C18H23F3N2O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-[[6-ethyl-5-methyl-1-(3-methylbut-3-enyl)-2-oxopyridine-3-carbonyl]amino]-4,4,4-trifluorobutanoic acid |
| SMILES | C=C(C)CCn1c(CC)c(C)cc(C(=O)NC(CC(=O)O)C(F)(F)F)c1=O |
| InChI | InChI=1S/C18H23F3N2O4/c1-5-13-11(4)8-12(17(27)23(13)7-6-10(2)3)16(26)22-14(9-15(24)25)18(19,20)21/h8,14H,2,5-7,9H2,1,3-4H3,(H,22,26)(H,24,25) |
| InChIKey | MOBAGAUPHWDZMK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|