C6H9F2N — CID 162552636
4-(difluoromethyl)-1,2,3,4-tetrahydropyridine (PubChem CID 162552636) has the molecular formula C6H9F2N and a molecular weight of 133.14 g/mol. Its IUPAC name is 4-(difluoromethyl)-1,2,3,4-tetrahydropyridine.
| Compound Name | 4-(difluoromethyl)-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 162552636 |
| Molecular Formula | C6H9F2N |
| Molecular Weight | 133.14 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 4-(difluoromethyl)-1,2,3,4-tetrahydropyridine |
| SMILES | FC(F)C1C=CNCC1 |
| InChI | InChI=1S/C6H9F2N/c7-6(8)5-1-3-9-4-2-5/h1,3,5-6,9H,2,4H2 |
| InChIKey | HNJBILZSTSMPQI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.14 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |