About 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol
1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol (PubChem CID 162552835) has the molecular formula C13H19F3O2
and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol.
Molecular Properties
| Compound Name | 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol |
| PubChem CID | 162552835 |
| Molecular Formula | C13H19F3O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol |
| SMILES | CCCC(O)CC1=CCC(C)C(OC(F)(F)F)=C1 |
| InChI | InChI=1S/C13H19F3O2/c1-3-4-11(17)7-10-6-5-9(2)12(8-10)18-13(14,15)16/h6,8-9,11,17H,3-5,7H2,1-2H3 |
| InChIKey | VPBRIJCYPHPUHY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol?
The IUPAC name of 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol (CID 162552835) is 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol.
What is the SMILES notation for 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol?
The canonical SMILES for 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol is CCCC(O)CC1=CCC(C)C(OC(F)(F)F)=C1.
What is the InChIKey of 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol?
The InChIKey is VPBRIJCYPHPUHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3O2/c1-3-4-11(17)7-10-6-5-9(2)12(8-10)18-13(14,15)16/h6,8-9,11,17H,3-5,7H2,1-2H3.
What are the key properties of 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol?
1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol has a molecular weight of 264.29 g/mol, XLogP of 3.92, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-methyl-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]pentan-2-ol is sourced from PubChem (CID 162552835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).