About 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole
2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole (PubChem CID 162553782) has the molecular formula C10H8F3NS
and a molecular weight of 231.24 g/mol. Its IUPAC name is 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole.
Molecular Properties
| Compound Name | 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole |
| PubChem CID | 162553782 |
| Molecular Formula | C10H8F3NS |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole |
| SMILES | Cc1nc2c(s1)=CCC(C(F)(F)F)=CC=2 |
| InChI | InChI=1S/C10H8F3NS/c1-6-14-8-4-2-7(10(11,12)13)3-5-9(8)15-6/h2,4-5H,3H2,1H3 |
| InChIKey | PJXKGEQRRQBQAG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole?
The IUPAC name of 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole (CID 162553782) is 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole.
What is the SMILES notation for 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole?
The canonical SMILES for 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole is Cc1nc2c(s1)=CCC(C(F)(F)F)=CC=2.
What is the InChIKey of 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole?
The InChIKey is PJXKGEQRRQBQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NS/c1-6-14-8-4-2-7(10(11,12)13)3-5-9(8)15-6/h2,4-5H,3H2,1H3.
What are the key properties of 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole?
2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole has a molecular weight of 231.24 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(trifluoromethyl)-7H-cyclohepta[d][1,3]thiazole is sourced from PubChem (CID 162553782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).