About 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine
5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine (PubChem CID 162554042) has the molecular formula C8H10F3N
and a molecular weight of 177.17 g/mol. Its IUPAC name is 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine |
| PubChem CID | 162554042 |
| Molecular Formula | C8H10F3N |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine |
| SMILES | CC1=C(C)NCC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C8H10F3N/c1-5-3-7(8(9,10)11)4-12-6(5)2/h3,12H,4H2,1-2H3 |
| InChIKey | APWDMIUNBNNARD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine?
The IUPAC name of 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine (CID 162554042) is 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine.
What is the SMILES notation for 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine?
The canonical SMILES for 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine is CC1=C(C)NCC(C(F)(F)F)=C1.
What is the InChIKey of 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine?
The InChIKey is APWDMIUNBNNARD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N/c1-5-3-7(8(9,10)11)4-12-6(5)2/h3,12H,4H2,1-2H3.
What are the key properties of 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine?
5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine has a molecular weight of 177.17 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-3-(trifluoromethyl)-1,2-dihydropyridine is sourced from PubChem (CID 162554042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).