C11H17F3N2 — CID 162554106
(E,2E)-N-ethyl-5,5,5-trifluoro-N,4-dimethyl-2-[(methylideneamino)methylidene]pent-3-en-1-amine (PubChem CID 162554106) has the molecular formula C11H17F3N2 and a molecular weight of 234.26 g/mol. Its IUPAC name is (E,2E)-N-ethyl-5,5,5-trifluoro-N,4-dimethyl-2-[(methylideneamino)methylidene]pent-3-en-1-amine.
| Compound Name | (E,2E)-N-ethyl-5,5,5-trifluoro-N,4-dimethyl-2-[(methylideneamino)methylidene]pent-3-en-1-amine |
|---|---|
| PubChem CID | 162554106 |
| Molecular Formula | C11H17F3N2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (E,2E)-N-ethyl-5,5,5-trifluoro-N,4-dimethyl-2-[(methylideneamino)methylidene]pent-3-en-1-amine |
| SMILES | C=N/C=C(\C=C(/C)C(F)(F)F)CN(C)CC |
| InChI | InChI=1S/C11H17F3N2/c1-5-16(4)8-10(7-15-3)6-9(2)11(12,13)14/h6-7H,3,5,8H2,1-2,4H3/b9-6+,10-7+ |
| InChIKey | NCXFEWIVWBRDHD-KZZDLZNXSA-N |
| XLogP | 3.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|