C22H21F6N5O — CID 162554310
7-[2-methyl-5-(trifluoromethyl)-2,3-dihydropyridin-6-yl]-4-[4-(trifluoromethyl)anilino]-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepin-2-one (PubChem CID 162554310) has the molecular formula C22H21F6N5O and a molecular weight of 485.43 g/mol. Its IUPAC name is 7-[2-methyl-5-(trifluoromethyl)-2,3-dihydropyridin-6-yl]-4-[4-(trifluoromethyl)anilino]-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepin-2-one.
| Compound Name | 7-[2-methyl-5-(trifluoromethyl)-2,3-dihydropyridin-6-yl]-4-[4-(trifluoromethyl)anilino]-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepin-2-one |
|---|---|
| PubChem CID | 162554310 |
| Molecular Formula | C22H21F6N5O |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 7-[2-methyl-5-(trifluoromethyl)-2,3-dihydropyridin-6-yl]-4-[4-(trifluoromethyl)anilino]-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepin-2-one |
| SMILES | CC1CC=C(C(F)(F)F)C(N2CCc3[nH]c(=O)nc(Nc4ccc(C(F)(F)F)cc4)c3CC2)=N1 |
| InChI | InChI=1S/C22H21F6N5O/c1-12-2-7-16(22(26,27)28)19(29-12)33-10-8-15-17(9-11-33)31-20(34)32-18(15)30-14-5-3-13(4-6-14)21(23,24)25/h3-7,12H,2,8-11H2,1H3,(H2,30,31,32,34) |
| InChIKey | HXMKNHRXVFOEPL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |