About 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine
3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine (PubChem CID 162554644) has the molecular formula C11H17F2N
and a molecular weight of 201.26 g/mol. Its IUPAC name is 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine.
Molecular Properties
| Compound Name | 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine |
| PubChem CID | 162554644 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine |
| SMILES | CC(C)C=C=CCN1CCC(F)(F)C1 |
| InChI | InChI=1S/C11H17F2N/c1-10(2)5-3-4-7-14-8-6-11(12,13)9-14/h4-5,10H,6-9H2,1-2H3 |
| InChIKey | JNVCMEHBAWKBKA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine?
The IUPAC name of 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine (CID 162554644) is 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine.
What is the SMILES notation for 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine?
The canonical SMILES for 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine is CC(C)C=C=CCN1CCC(F)(F)C1.
What is the InChIKey of 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine?
The InChIKey is JNVCMEHBAWKBKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N/c1-10(2)5-3-4-7-14-8-6-11(12,13)9-14/h4-5,10H,6-9H2,1-2H3.
What are the key properties of 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine?
3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine has a molecular weight of 201.26 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1-(5-methylhexa-2,3-dienyl)pyrrolidine is sourced from PubChem (CID 162554644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).