C29H41ClF3N5O4S — CID 162554890
[(2R,6S)-4-[[3-chloro-5-(trifluoromethyl)phenyl]methyl-[5-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-2-yl]amino]-2,6-diethylpiperidin-1-yl]-propan-2-yloxymethanol (PubChem CID 162554890) has the molecular formula C29H41ClF3N5O4S and a molecular weight of 648.19 g/mol. Its IUPAC name is [(2R,6S)-4-[[3-chloro-5-(trifluoromethyl)phenyl]methyl-[5-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-2-yl]amino]-2,6-diethylpiperidin-1-yl]-propan-2-yloxymethanol.
| Compound Name | [(2R,6S)-4-[[3-chloro-5-(trifluoromethyl)phenyl]methyl-[5-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-2-yl]amino]-2,6-diethylpiperidin-1-yl]-propan-2-yloxymethanol |
|---|---|
| PubChem CID | 162554890 |
| Molecular Formula | C29H41ClF3N5O4S |
| Molecular Weight | 648.19 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | [(2R,6S)-4-[[3-chloro-5-(trifluoromethyl)phenyl]methyl-[5-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-2-yl]amino]-2,6-diethylpiperidin-1-yl]-propan-2-yloxymethanol |
| SMILES | CC[C@@H]1CC(N(Cc2cc(Cl)cc(C(F)(F)F)c2)c2ncc(N3CCS(=O)(=O)CC3)cn2)C[C@H](CC)N1C(O)OC(C)C |
| InChI | InChI=1S/C29H41ClF3N5O4S/c1-5-23-14-25(15-24(6-2)38(23)28(39)42-19(3)4)37(18-20-11-21(29(31,32)33)13-22(30)12-20)27-34-16-26(17-35-27)36-7-9-43(40,41)10-8-36/h11-13,16-17,19,23-25,28,39H,5-10,14-15,18H2,1-4H3/t23-,24+,25?,28? |
| InChIKey | TVMYUWVJYRPKGN-QZISUJDASA-N |
| XLogP | 5.11 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.19 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|