C24H28F3N3O5 — CID 162555029
(1R,12E,23S)-3,21-dioxo-18-(trifluoromethyl)-2-oxa-4,19,22-triazatetracyclo[20.2.1.14,7.06,11]hexacosa-6,8,10,12-tetraene-23-carboxylic acid (PubChem CID 162555029) has the molecular formula C24H28F3N3O5 and a molecular weight of 495.50 g/mol. Its IUPAC name is (1R,12E,23S)-3,21-dioxo-18-(trifluoromethyl)-2-oxa-4,19,22-triazatetracyclo[20.2.1.14,7.06,11]hexacosa-6,8,10,12-tetraene-23-carboxylic acid.
| Compound Name | (1R,12E,23S)-3,21-dioxo-18-(trifluoromethyl)-2-oxa-4,19,22-triazatetracyclo[20.2.1.14,7.06,11]hexacosa-6,8,10,12-tetraene-23-carboxylic acid |
|---|---|
| PubChem CID | 162555029 |
| Molecular Formula | C24H28F3N3O5 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (1R,12E,23S)-3,21-dioxo-18-(trifluoromethyl)-2-oxa-4,19,22-triazatetracyclo[20.2.1.14,7.06,11]hexacosa-6,8,10,12-tetraene-23-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H]2CN1C(=O)CNC(C(F)(F)F)CCCC/C=C/c1cccc3c1CN(C3)C(=O)O2 |
| InChI | InChI=1S/C24H28F3N3O5/c25-24(26,27)20-9-4-2-1-3-6-15-7-5-8-16-12-29(14-18(15)16)23(34)35-17-10-19(22(32)33)30(13-17)21(31)11-28-20/h3,5-8,17,19-20,28H,1-2,4,9-14H2,(H,32,33)/b6-3+/t17-,19+,20?/m1/s1 |
| InChIKey | NEVZIGRGSTZTJG-KLEONAMWSA-N |
| XLogP | 3.30 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |